Difference between revisions of "CPD-17348"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17608 RXN-17608] == * direction: ** REVERSIBLE * common name: ** Amidase * ec number: ** [http:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * smiles: ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17608 RXN-17608] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** Amidase
+
** (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/3.5.1.4 EC-3.5.1.4]
+
** InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J
 +
* molecular weight:
 +
** 1051.975   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-16097]]
** 1 [[CPD-19042]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[CPD-19014]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-16096]]
** 1 2-hydroxyisobutyramide[c] '''+''' 1 H2O[c] '''<=>''' 1 ammonium[c] '''+''' 1 2-hydroxyisobutanoate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-06_009020]]
+
** ESILICULOSUS_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[Ec-02_005910]]
+
** ESILICULOSUS_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
{{#set: common name=Amidase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193765 72193765]
{{#set: ec number=EC-3.5.1.4}}
+
* CHEBI:
{{#set: gene associated=Ec-06_009020|Ec-02_005910}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76409 76409]
{{#set: in pathway=}}
+
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reconstruction category=annotation}}
+
{{#set: common name=(2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA}}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=1051.975    }}
 +
{{#set: consumed by=RXN-16097}}
 +
{{#set: produced by=RXN-16096}}

Latest revision as of 19:10, 21 March 2018

Metabolite CPD-17348

  • smiles:
    • CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA
  • inchi key:
    • InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J
  • molecular weight:
    • 1051.975
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.