Difference between revisions of "PWY-7397"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7397 PWY-7397] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7397 PWY-7397] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
** InChIKey=XSIBQUOFLNIVEK-XPBIURITSA-J
+
 
* common name:
 
* common name:
** trans-adre-2-enoyl-CoA
+
** naringenin biosynthesis (engineered)
* molecular weight:
+
** 1075.997   
+
 
* Synonym(s):
 
* Synonym(s):
** (2E,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA
 
** (2E,7Z,10Z,13Z,16Z)-docosa-2,7,10,13,16-pentaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16114]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
* [[RXN-16113]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-10_001480]]
 +
*** [[Ec-04_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[APIGNAR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-00_005930]]
 +
*** [[Ec-05_001880]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-07_006660]]
 +
*** [[Ec-02_004580]]
 +
*** [[Ec-07_003670]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9697 RXN-9697]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193787 72193787]
+
{{#set: taxonomic range=TAX-33090}}
* CHEBI:
+
{{#set: common name=naringenin biosynthesis (engineered)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76416 76416]
+
{{#set: reaction found=3}}
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: total reaction=4}}
{{#set: inchi key=InChIKey=XSIBQUOFLNIVEK-XPBIURITSA-J}}
+
{{#set: completion rate=75.0}}
{{#set: common name=trans-adre-2-enoyl-CoA}}
+
{{#set: molecular weight=1075.997    }}
+
{{#set: common name=(2E,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA|(2E,7Z,10Z,13Z,16Z)-docosa-2,7,10,13,16-pentaenoyl-CoA}}
+
{{#set: consumed by=RXN-16114}}
+
{{#set: produced by=RXN-16113}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-7397

  • taxonomic range:
  • common name:
    • naringenin biosynthesis (engineered)
  • Synonym(s):

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links