Difference between revisions of "CPD-17368"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_000770 == * Synonym(s): ** Esi_0027_0032 ** Esi0027_0032 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17368 CPD-17368] == |
| + | * smiles: | ||
| + | ** CCCCCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=XSIBQUOFLNIVEK-XPBIURITSA-J | ||
| + | * common name: | ||
| + | ** trans-adre-2-enoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 1075.997 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (2E,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA |
| − | ** | + | ** (2E,7Z,10Z,13Z,16Z)-docosa-2,7,10,13,16-pentaenoyl-CoA |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-16114]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-16113]] |
| − | + | == Reaction(s) of unknown directionality == | |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193787 72193787] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76416 76416] | ||
| + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=XSIBQUOFLNIVEK-XPBIURITSA-J}} | ||
| + | {{#set: common name=trans-adre-2-enoyl-CoA}} | ||
| + | {{#set: molecular weight=1075.997 }} | ||
| + | {{#set: common name=(2E,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA|(2E,7Z,10Z,13Z,16Z)-docosa-2,7,10,13,16-pentaenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-16114}} | ||
| + | {{#set: produced by=RXN-16113}} | ||
Latest revision as of 19:10, 21 March 2018
Contents
Metabolite CPD-17368
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=XSIBQUOFLNIVEK-XPBIURITSA-J
- common name:
- trans-adre-2-enoyl-CoA
- molecular weight:
- 1075.997
- Synonym(s):
- (2E,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA
- (2E,7Z,10Z,13Z,16Z)-docosa-2,7,10,13,16-pentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
