Difference between revisions of "Ec-14 001140"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...")
 
(Created page with "Category:Gene == Gene Ec-14_001140 == * left end position: ** 1113431 * transcription direction: ** NEGATIVE * right end position: ** 1131168 * centisome position: ** 16.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
+
== Gene Ec-14_001140 ==
−
* smiles:
+
* left end position:
−
** C(C1(C=C(C(=CC=1)O)O))=O
+
** 1113431
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** protocatechualdehyde
+
** 1131168
−
* molecular weight:
+
* centisome position:
−
** 138.123    
+
** 16.971926    
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-dihydroxybenzaldehyde
+
** Esi_0256_0016
−
** 3,4-dihydroxybenzyl aldehyde
+
** Esi0256_0016
−
** rancinamycin IV
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN-8872]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1113431}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=1131168}}
−
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
+
{{#set: centisome position=16.971926   }}
−
* CHEBI:
+
{{#set: common name=Esi_0256_0016|Esi0256_0016}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
+
−
* HMDB : HMDB59965
+
−
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
+
−
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
+
−
{{#set: common name=protocatechualdehyde}}
+
−
{{#set: molecular weight=138.123   }}
+
−
{{#set: common name=3,4-dihydroxybenzaldehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
+
−
{{#set: produced by=RXN-8872}}
+

Latest revision as of 19:10, 21 March 2018

Gene Ec-14_001140

  • left end position:
    • 1113431
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1131168
  • centisome position:
    • 16.971926
  • Synonym(s):
    • Esi_0256_0016
    • Esi0256_0016

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_001140&oldid=25026"