Difference between revisions of "CPD-7616"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-05_004440 == * Synonym(s): ** Esi_0129_0022 ** Esi0129_0022 ** CDKB2 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == |
| + | * smiles: | ||
| + | ** C(C1(C=C(C(=CC=1)O)O))=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** protocatechualdehyde | ||
| + | * molecular weight: | ||
| + | ** 138.123 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3,4-dihydroxybenzaldehyde |
| − | ** | + | ** 3,4-dihydroxybenzyl aldehyde |
| − | ** | + | ** rancinamycin IV |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-8872]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.8438.html 8438] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700] | ||
| + | * HMDB : HMDB59965 | ||
| + | {{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}} | ||
| + | {{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=protocatechualdehyde}} | ||
| + | {{#set: molecular weight=138.123 }} | ||
| + | {{#set: common name=3,4-dihydroxybenzaldehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}} | ||
| + | {{#set: produced by=RXN-8872}} | ||
Latest revision as of 20:10, 21 March 2018
Contents
Metabolite CPD-7616
- smiles:
- C(C1(C=C(C(=CC=1)O)O))=O
- inchi key:
- InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
- common name:
- protocatechualdehyde
- molecular weight:
- 138.123
- Synonym(s):
- 3,4-dihydroxybenzaldehyde
- 3,4-dihydroxybenzyl aldehyde
- rancinamycin IV
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
