Difference between revisions of "RXN-13202"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13202 RXN-13202] == * direction: ** LEFT-TO-RIGHT * common name: ** carbamoyl-phosphate synthas...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13202 RXN-13202] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C1(=CC=CC(C1O)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M
+
 
* common name:
 
* common name:
−
** (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate
+
** carbamoyl-phosphate synthase (glutamine-hydrolyzing)
−
* molecular weight:
+
* ec number:
−
** 155.13   
+
** [http://enzyme.expasy.org/EC/6.3.4.16 EC-6.3.4.16]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[DHBDEHYD-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[HCO3]][c] '''+''' 2 [[ATP]][c] '''+''' 1 [[AMMONIUM]][c] '''=>''' 1 [[CARBAMOYL-P]][c] '''+''' 1 [[Pi]][c] '''+''' 2 [[ADP]][c] '''+''' 2 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 hydrogen carbonate[c] '''+''' 2 ATP[c] '''+''' 1 ammonium[c] '''=>''' 1 carbamoyl phosphate[c] '''+''' 1 phosphate[c] '''+''' 2 ADP[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_006110]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-4984]], urea cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4984 PWY-4984]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266758 45266758]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10624 10624]
−
* CHEMSPIDER:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18030 18030]
−
** [http://www.chemspider.com/Chemical-Structure.19951064.html 19951064]
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00149 R00149]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58764 58764]
+
* UNIPROT:
−
* BIGG : 43290
+
** [http://www.uniprot.org/uniprot/O15829 O15829]
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/O15830 O15830]
−
** [http://www.genome.jp/dbget-bin/www_bget?C04171 C04171]
+
** [http://www.uniprot.org/uniprot/P07756 P07756]
−
{{#set: smiles=C([O-])(=O)C1(=CC=CC(C1O)O)}}
+
** [http://www.uniprot.org/uniprot/P31327 P31327]
−
{{#set: inchi key=InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=(2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate}}
+
{{#set: common name=carbamoyl-phosphate synthase (glutamine-hydrolyzing)}}
−
{{#set: molecular weight=155.13    }}
+
{{#set: ec number=EC-6.3.4.16}}
−
{{#set: consumed by=DHBDEHYD-RXN}}
+
{{#set: gene associated=Ec-10_006110}}
 +
{{#set: in pathway=PWY-4984}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:10, 21 March 2018

Reaction RXN-13202

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • carbamoyl-phosphate synthase (glutamine-hydrolyzing)
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 hydrogen carbonate[c] + 2 ATP[c] + 1 ammonium[c] => 1 carbamoyl phosphate[c] + 1 phosphate[c] + 2 ADP[c] + 2 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-4984, urea cycle: PWY-4984
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13202&oldid=25032"