Difference between revisions of "RXN-13202"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13202 RXN-13202] == * direction: ** LEFT-TO-RIGHT * common name: ** carbamoyl-phosphate synthas...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13202 RXN-13202] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** ( | + | ** carbamoyl-phosphate synthase (glutamine-hydrolyzing) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.3.4.16 EC-6.3.4.16] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[HCO3]][c] '''+''' 2 [[ATP]][c] '''+''' 1 [[AMMONIUM]][c] '''=>''' 1 [[CARBAMOYL-P]][c] '''+''' 1 [[Pi]][c] '''+''' 2 [[ADP]][c] '''+''' 2 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 hydrogen carbonate[c] '''+''' 2 ATP[c] '''+''' 1 ammonium[c] '''=>''' 1 carbamoyl phosphate[c] '''+''' 1 phosphate[c] '''+''' 2 ADP[c] '''+''' 2 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-10_006110]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY-4984]], urea cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4984 PWY-4984] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10624 10624] |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18030 18030] |
− | ** [http://www. | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00149 R00149] |
− | ** [http://www. | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/O15829 O15829] |
− | * | + | ** [http://www.uniprot.org/uniprot/O15830 O15830] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P07756 P07756] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P31327 P31327] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=carbamoyl-phosphate synthase (glutamine-hydrolyzing)}} |
− | {{#set: | + | {{#set: ec number=EC-6.3.4.16}} |
− | {{#set: | + | {{#set: gene associated=Ec-10_006110}} |
+ | {{#set: in pathway=PWY-4984}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:10, 21 March 2018
Contents
Reaction RXN-13202
- direction:
- LEFT-TO-RIGHT
- common name:
- carbamoyl-phosphate synthase (glutamine-hydrolyzing)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 hydrogen carbonate[c] + 2 ATP[c] + 1 ammonium[c] => 1 carbamoyl phosphate[c] + 1 phosphate[c] + 2 ADP[c] + 2 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-10_006110
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links