Difference between revisions of "RXN-113"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-113 RXN-113] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-113 RXN-113] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-140]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-236]][c] '''+''' 1 [[SUC]][c] |
| − | == | + | * With common name(s): |
| − | == | + | ** 1 oxygen[c] '''+''' 1 gibberellin A20[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 CO2[c] '''+''' 1 gibberellin A29[c] '''+''' 1 succinate[c] |
| − | * [[ | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-19_002760]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | * Gene: [[Ec-19_002750]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | * Gene: [[Ec-08_003510]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | == Pathways == | ||
| + | * [[PWY-102]], gibberellin inactivation I (2β-hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102] | ||
| + | ** '''4''' reactions found over '''11''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-aragem]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03809 R03809] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.14.11}} | |
| − | + | {{#set: gene associated=Ec-19_002760|Ec-19_002750|Ec-08_003510}} | |
| − | * LIGAND- | + | {{#set: in pathway=PWY-102}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
| − | + | {{#set: reconstruction source=orthology-aragem}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:10, 21 March 2018
Contents
Reaction RXN-113
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 CPD1F-140[c] + 1 2-KETOGLUTARATE[c] => 1 CARBON-DIOXIDE[c] + 1 CPD-236[c] + 1 SUC[c]
- With common name(s):
- 1 oxygen[c] + 1 gibberellin A20[c] + 1 2-oxoglutarate[c] => 1 CO2[c] + 1 gibberellin A29[c] + 1 succinate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-19_002760
- Source: orthology-aragem
- Gene: Ec-19_002750
- Source: orthology-aragem
- Gene: Ec-08_003510
- Source: orthology-aragem
Pathways
- PWY-102, gibberellin inactivation I (2β-hydroxylation): PWY-102
- 4 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
External links
- LIGAND-RXN:
