Difference between revisions of "PWY-6287"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1083 CPD0-1083] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)O * inchi key: ** InChIKey=RGH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6287 PWY-6287] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6287 PWY-6287] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** neurosporene biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''5''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[2.5.1.32-RXN]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
+ | *** [[Ec-04_002810]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXNARA-8002]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-04_002810]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8022 RXN-8022] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8023 RXN-8023] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8024 RXN-8024] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=neurosporene biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=40.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:10, 21 March 2018
Pathway PWY-6287
- taxonomic range:
- common name:
- neurosporene biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- 2.5.1.32-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXNARA-8002
- 1 associated gene(s):
- 1 reconstruction source(s) associated: