Difference between revisions of "Ec-24 003520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...")
 
(Created page with "Category:Gene == Gene Ec-24_003520 == * left end position: ** 3837228 * transcription direction: ** POSITIVE * right end position: ** 3839956 * centisome position: ** 76.9...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] ==
+
== Gene Ec-24_003520 ==
−
* smiles:
+
* left end position:
−
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 3837228
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** gibberellin A20
+
** 3839956
−
* molecular weight:
+
* centisome position:
−
** 331.388    
+
** 76.93425    
 
* Synonym(s):
 
* Synonym(s):
−
** GA20
+
** Esi_0034_0074
 +
** Esi0034_0074
 +
** SATase
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-113]]
+
* Reaction: [[SERINE-O-ACETTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[CYSTSYN-PWY]]
 +
* [[PWY-7274]]
 +
* [[PWY-6936]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3837228}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3839956}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742]
+
{{#set: centisome position=76.93425   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0034_0074|Esi0034_0074|SATase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035]
+
{{#set: reaction associated=SERINE-O-ACETTRAN-RXN}}
−
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: pathway associated=CYSTSYN-PWY|PWY-7274|PWY-6936}}
−
{{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}}
+
−
{{#set: common name=gibberellin A20}}
+
−
{{#set: molecular weight=331.388   }}
+
−
{{#set: common name=GA20}}
+
−
{{#set: consumed by=RXN-113}}
+

Latest revision as of 19:10, 21 March 2018

Gene Ec-24_003520

  • left end position:
    • 3837228
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3839956
  • centisome position:
    • 76.93425
  • Synonym(s):
    • Esi_0034_0074
    • Esi0034_0074
    • SATase

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_003520&oldid=25054"