Difference between revisions of "2PHENDEG-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] == * smiles: ** CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=2PHENDEG-PWY 2PHENDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-332...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=2PHENDEG-PWY 2PHENDEG-PWY] ==
* smiles:
+
* taxonomic range:
** CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=HVXCCJIYXIZGOP-NADLOITOSA-J
+
 
* common name:
 
* common name:
** 3-trans-undecenoyl-CoA
+
** phenylethylamine degradation I
* molecular weight:
+
** 929.765   
+
 
* Synonym(s):
 
* Synonym(s):
** 3E-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
* [[RXN-14776]]
+
* [[AMINEPHEN-RXN]]
* [[RXN-14790]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-15_002920]]
 +
*** [[Ec-15_002910]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PHENDEHYD-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659203 90659203]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=2PHENDEG-PWY 2PHENDEG-PWY]
{{#set: smiles=CCCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-33208}}
{{#set: inchi key=InChIKey=HVXCCJIYXIZGOP-NADLOITOSA-J}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=3-trans-undecenoyl-CoA}}
+
{{#set: common name=phenylethylamine degradation I}}
{{#set: molecular weight=929.765    }}
+
{{#set: reaction found=2}}
{{#set: common name=3E-undecenoyl-CoA}}
+
{{#set: total reaction=2}}
{{#set: produced by=RXN-14776|RXN-14790}}
+
{{#set: completion rate=100.0}}

Latest revision as of 20:10, 21 March 2018

Pathway 2PHENDEG-PWY

  • taxonomic range:
  • common name:
    • phenylethylamine degradation I
  • Synonym(s):

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links