Difference between revisions of "PWY-5905"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] == * smiles: ** C1(C=C(Cl)C(=CC=1[N+]([O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5905 PWY-5905] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5905 PWY-5905] ==
* smiles:
+
* taxonomic range:
** C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 1-chloro-2,4-dinitrobenzene
+
** hypusine biosynthesis
* molecular weight:
+
** 202.554   
+
 
* Synonym(s):
 
* Synonym(s):
** CDNB
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
* [[GST-RXN]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13414]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002000]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13415]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002000]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13416]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002000]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-13417]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002000]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6 6]
+
{{#set: common name=hypusine biosynthesis}}
* CHEMSPIDER:
+
{{#set: reaction found=5}}
** [http://www.chemspider.com/Chemical-Structure.13868426.html 13868426]
+
{{#set: total reaction=5}}
* NCI:
+
{{#set: completion rate=100.0}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6292 6292]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34718 34718]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C14397 C14397]
+
{{#set: smiles=C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)}}
+
{{#set: inchi key=InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N}}
+
{{#set: common name=1-chloro-2,4-dinitrobenzene}}
+
{{#set: molecular weight=202.554    }}
+
{{#set: common name=CDNB}}
+
{{#set: consumed or produced by=GST-RXN}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-5905

  • taxonomic range:
  • common name:
    • hypusine biosynthesis
  • Synonym(s):

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links