Difference between revisions of "PWY-5871"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5871 PWY-5871] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5871 PWY-5871] ==
* smiles:
+
* taxonomic range:
** C([O-])(=O)C1(=CC=CC(C1O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M
+
 
* common name:
 
* common name:
** (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate
+
** ubiquinol-9 biosynthesis (eukaryotic)
* molecular weight:
+
** 155.13   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Q9 biosynthesis
 +
** ubiquinone-9 biosynthesis (eukaryotic)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[DHBDEHYD-RXN]]
+
'''1''' reactions found over '''8''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2.5.1.39-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-00_007360]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.64-RXN 2.1.1.64-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9241 RXN-9241]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9242 RXN-9242]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9243 RXN-9243]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9278 RXN-9278]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9281 RXN-9281]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9284 RXN-9284]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266758 45266758]
+
{{#set: common name=ubiquinol-9 biosynthesis (eukaryotic)}}
* CHEMSPIDER:
+
{{#set: common name=Q9 biosynthesis|ubiquinone-9 biosynthesis (eukaryotic)}}
** [http://www.chemspider.com/Chemical-Structure.19951064.html 19951064]
+
{{#set: reaction found=1}}
* CHEBI:
+
{{#set: total reaction=8}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58764 58764]
+
{{#set: completion rate=13.0}}
* BIGG : 43290
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04171 C04171]
+
{{#set: smiles=C([O-])(=O)C1(=CC=CC(C1O)O)}}
+
{{#set: inchi key=InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M}}
+
{{#set: common name=(2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate}}
+
{{#set: molecular weight=155.13    }}
+
{{#set: consumed by=DHBDEHYD-RXN}}
+

Latest revision as of 20:10, 21 March 2018

Pathway PWY-5871

  • taxonomic range:
  • common name:
    • ubiquinol-9 biosynthesis (eukaryotic)
  • Synonym(s):
    • Q9 biosynthesis
    • ubiquinone-9 biosynthesis (eukaryotic)

Reaction(s) found

1 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links