Difference between revisions of "CPD-15818"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-SYN2-PWY ALANINE-SYN2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == |
− | * | + | * smiles: |
− | ** [ | + | ** [CH](=O)C(O)C(O)C(O)CO |
− | ** | + | * inchi key: |
+ | ** InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** aldehydo-D-ribose |
+ | * molecular weight: | ||
+ | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14883]] | |
− | + | * [[RXN-14882]] | |
− | + | * [[RXN0-5305]] | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5311110 5311110] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47014 47014] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC47014 |
− | {{#set: | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N}} |
− | + | {{#set: common name=aldehydo-D-ribose}} | |
+ | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: reversible reaction associated=RXN-14883|RXN-14882|RXN0-5305}} |
Latest revision as of 19:11, 21 March 2018
Contents
Metabolite CPD-15818
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
- common name:
- aldehydo-D-ribose
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.