Difference between revisions of "Ec-10 006240"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] == * smiles: ** C1(C=C(Cl)C(=CC=1[N+]([O...")
(Created page with "Category:Gene == Gene Ec-10_006240 == * left end position: ** 6283004 * transcription direction: ** POSITIVE * right end position: ** 6291692 * centisome position: ** 96.6...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] ==
+
== Gene Ec-10_006240 ==
* smiles:
+
* left end position:
** C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)
+
** 6283004
* inchi key:
+
* transcription direction:
** InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N
+
** POSITIVE
* common name:
+
* right end position:
** 1-chloro-2,4-dinitrobenzene
+
** 6291692
* molecular weight:
+
* centisome position:
** 202.554    
+
** 96.64695    
 
* Synonym(s):
 
* Synonym(s):
** CDNB
+
** Esi_0006_0200
 +
** Esi0006_0200
 +
** CYP51C1
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.14.13.70-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[GST-RXN]]
+
*** Assignment: ec-number
 +
* Reaction: [[1.14.13.79-RXN]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-1121]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-11881]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13707]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13961]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-3661]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-4225]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-4231]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-715]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-773]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-8038]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-8040]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-147]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-148]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-150]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-151]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-160]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-161]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN3O-130]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-11]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-12]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-13]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-303]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-304]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-305]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY66-341]]
 +
* [[PWY-2541]]
 +
* [[PWY-699]]
 +
* [[PWY-7591]]
 +
* [[PWY-6074]]
 +
* [[PWY-2181]]
 +
* [[PWY-2582]]
 +
* [[PWY-5034]]
 +
* [[PWY-5947]]
 +
* [[PWY-5047]]
 +
* [[PWY66-3]]
 +
* [[PWY66-4]]
 +
* [[PWY-5640]]
 +
* [[PWY-5946]]
 +
* [[PWY-5943]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=6283004}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6 6]
+
{{#set: transcription direction=POSITIVE}}
* CHEMSPIDER:
+
{{#set: right end position=6291692}}
** [http://www.chemspider.com/Chemical-Structure.13868426.html 13868426]
+
{{#set: centisome position=96.64695   }}
* NCI:
+
{{#set: common name=Esi_0006_0200|Esi0006_0200|CYP51C1}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6292 6292]
+
{{#set: reaction associated=1.14.13.70-RXN|1.14.13.79-RXN|RXN-1121|RXN-11881|RXN-13707|RXN-13961|RXN-3661|RXN-4225|RXN-4231|RXN-715|RXN-773|RXN-8038|RXN-8040|RXN1F-147|RXN1F-148|RXN1F-150|RXN1F-151|RXN1F-160|RXN1F-161|RXN3O-130|RXN66-11|RXN66-12|RXN66-13|RXN66-303|RXN66-304|RXN66-305|UNSPECIFIC-MONOOXYGENASE-RXN}}
* CHEBI:
+
{{#set: pathway associated=PWY66-341|PWY-2541|PWY-699|PWY-7591|PWY-6074|PWY-2181|PWY-2582|PWY-5034|PWY-5947|PWY-5047|PWY66-3|PWY66-4|PWY-5640|PWY-5946|PWY-5943}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34718 34718]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C14397 C14397]
+
{{#set: smiles=C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)}}
+
{{#set: inchi key=InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N}}
+
{{#set: common name=1-chloro-2,4-dinitrobenzene}}
+
{{#set: molecular weight=202.554   }}
+
{{#set: common name=CDNB}}
+
{{#set: reversible reaction associated=GST-RXN}}
+

Latest revision as of 19:11, 21 March 2018

Gene Ec-10_006240

  • left end position:
    • 6283004
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6291692
  • centisome position:
    • 96.64695
  • Synonym(s):
    • Esi_0006_0200
    • Esi0006_0200
    • CYP51C1

Reactions associated

Pathways associated

External links