Difference between revisions of "CPD-15152"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_001540 == * left end position: ** 1547296 * transcription direction: ** POSITIVE * right end position: ** 1558640 * centisome position: ** 30.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N |
− | * | + | * common name: |
− | ** | + | ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone |
− | * | + | * molecular weight: |
− | ** | + | ** 683.068 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14177]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05813 C05813] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28423 28423] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280835 5280835] |
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)}} | ||
+ | {{#set: inchi key=InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N}} | ||
+ | {{#set: common name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}} | ||
+ | {{#set: molecular weight=683.068 }} | ||
+ | {{#set: consumed by=RXN-14177}} |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-15152
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)
- inchi key:
- InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N
- common name:
- 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
- molecular weight:
- 683.068
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links