Difference between revisions of "RXN66-305"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] == * direction: ** LEFT-TO-RIGHT * common name: ** 14-oxolanosterol deformylas...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 14-oxolanosterol deformylase |
− | + | ** Cytochrome P450 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-4573]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[44-DIMETHYL-CHOLESTA-812-24-TRIENOL]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[FORMATE]][c] |
− | = | + | * With common name(s): |
+ | ** 1 14-oxolanosterol[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 1 4,4-dimethyl-cholesta-8,12,24-trienol[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c] '''+''' 1 formate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-10_006240]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341] | ||
+ | ** '''9''' reactions found over '''22''' reactions in the full pathway | ||
+ | * [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4] | ||
+ | ** '''9''' reactions found over '''22''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=14-oxolanosterol deformylase}} | |
− | + | {{#set: common name=Cytochrome P450}} | |
− | + | {{#set: gene associated=Ec-10_006240}} | |
− | + | {{#set: in pathway=PWY66-341|PWY66-4}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:11, 21 March 2018
Contents
Reaction RXN66-305
- direction:
- LEFT-TO-RIGHT
- common name:
- 14-oxolanosterol deformylase
- Cytochrome P450
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-4573[c] + 1 OXYGEN-MOLECULE[c] + 1 NADPH[c] => 1 44-DIMETHYL-CHOLESTA-812-24-TRIENOL[c] + 1 WATER[c] + 1 NADP[c] + 1 FORMATE[c]
- With common name(s):
- 1 14-oxolanosterol[c] + 1 oxygen[c] + 1 NADPH[c] => 1 4,4-dimethyl-cholesta-8,12,24-trienol[c] + 1 H2O[c] + 1 NADP+[c] + 1 formate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-10_006240
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY66-341, cholesterol biosynthesis I: PWY66-341
- 9 reactions found over 22 reactions in the full pathway
- PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
- 9 reactions found over 22 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome