Difference between revisions of "PWY-6978"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6978 PWY-6978] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6978 PWY-6978] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** plastoquinol-9 biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** plastoquinone biosynthesis II | ||
| + | ** plastoquinone-9 biosynthesis II | ||
| + | ** plastoquinol biosynthesis II | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''5''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[2.5.1.39-RXN]] |
| − | == | + | ** 1 associated gene(s): |
| + | *** [[Ec-00_007360]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12944 RXN-12944] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15308 RXN-15308] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2762 RXN-2762] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9238 RXN-9238] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1117}} | |
| − | + | {{#set: common name=plastoquinol-9 biosynthesis II}} | |
| − | + | {{#set: common name=plastoquinone biosynthesis II|plastoquinone-9 biosynthesis II|plastoquinol biosynthesis II}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=20.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:11, 21 March 2018
Pathway PWY-6978
- taxonomic range:
- common name:
- plastoquinol-9 biosynthesis II
- Synonym(s):
- plastoquinone biosynthesis II
- plastoquinone-9 biosynthesis II
- plastoquinol biosynthesis II
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- 2.5.1.39-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
