Difference between revisions of "PWY-5122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5122 PWY-5122] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5122 PWY-5122] ==
* smiles:
+
* taxonomic range:
** C12(NC(=O)NC=1C(=O)NC(=O)N2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
** urate
+
** geranyl diphosphate biosynthesis
* molecular weight:
+
** 168.112   
+
 
* Synonym(s):
 
* Synonym(s):
** 2,6,8-trioxypurine
+
** GPP biosynthesis
** purine-2,6,8-(1H,3H,9H)-trione
+
** 7,9-dihydro-1H-purine-2,6,8(3H)-trione
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[URATE-OXIDASE-RXN]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GPPSYN-RXN]]
* [[XANTHINE-OXIDASE-RXN]]
+
** 12 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-21_000990]]
* [[RXN0-901]]
+
*** [[Ec-14_006550]]
 +
*** [[Ec-08_002270]]
 +
*** [[Ec-00_007350]]
 +
*** [[Ec-25_002110]]
 +
*** [[Ec-10_003020]]
 +
*** [[Ec-18_000990]]
 +
*** [[Ec-26_003280]]
 +
*** [[Ec-17_001240]]
 +
*** [[Ec-16_004330]]
 +
*** [[Ec-07_006170]]
 +
*** [[Ec-24_003910]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 69-93-2
+
* ARACYC:
* Wikipedia : Uric_acid
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5122 PWY-5122]
* BIGG : 34768
+
{{#set: taxonomic range=TAX-2157}}
* DRUGBANK : DB01696
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229235 44229235]
+
{{#set: common name=geranyl diphosphate biosynthesis}}
* HMDB : HMDB00289
+
{{#set: common name=GPP biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C00366 C00366]
+
{{#set: total reaction=1}}
* CHEBI:
+
{{#set: completion rate=100.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17775 17775]
+
* METABOLIGHTS : MTBLC17775
+
{{#set: smiles=C12(NC(=O)NC=1C(=O)NC(=O)N2)}}
+
{{#set: inchi key=InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N}}
+
{{#set: common name=urate}}
+
{{#set: molecular weight=168.112    }}
+
{{#set: common name=2,6,8-trioxypurine|purine-2,6,8-(1H,3H,9H)-trione|7,9-dihydro-1H-purine-2,6,8(3H)-trione}}
+
{{#set: consumed by=URATE-OXIDASE-RXN}}
+
{{#set: produced by=XANTHINE-OXIDASE-RXN}}
+
{{#set: reversible reaction associated=RXN0-901}}
+

Latest revision as of 19:11, 21 March 2018

Pathway PWY-5122

  • taxonomic range:
  • common name:
    • geranyl diphosphate biosynthesis
  • Synonym(s):
    • GPP biosynthesis

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links