Difference between revisions of "NADH-DEHYDROGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-468 CPD-468] == * smiles: ** C([O-])(=O)CCCC(C(=O)[O-])[N+] * inchi key: ** InChIKey=OYIFNH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADH-DEHYDROGENASE-RXN NADH-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE * common name: ** NADH...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NADH-DEHYDROGENASE-RXN NADH-DEHYDROGENASE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** NADH dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.6.99.3 EC-1.6.99.3] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Acceptor]][c] '''<=>''' 1 [[NAD]][c] '''+''' 1 [[Donor-H2]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 an oxidized unknown electron acceptor[c] '''<=>''' 1 NAD+[c] '''+''' 1 an reduced unknown electron acceptor[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-02_006350]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11356 11356] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00281 R00281] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P21301 P21301] |
− | * | + | ** [http://www.uniprot.org/uniprot/O05267 O05267] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P04394 P04394] |
− | * | + | ** [http://www.uniprot.org/uniprot/P80861 P80861] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P44856 P44856] |
− | * | + | ** [http://www.uniprot.org/uniprot/P00393 P00393] |
− | + | ** [http://www.uniprot.org/uniprot/P52504 P52504] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O75380 O75380] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M2F7 Q7M2F7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M2F8 Q7M2F8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M2G8 Q7M2G8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M2F9 Q7M2F9] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M2G0 Q7M2G0] |
+ | ** [http://www.uniprot.org/uniprot/Q7M2G1 Q7M2G1] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M2G2 Q7M2G2] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M2G3 Q7M2G3] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M2G4 Q7M2G4] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M2G7 Q7M2G7] | ||
+ | ** [http://www.uniprot.org/uniprot/P23934 P23934] | ||
+ | ** [http://www.uniprot.org/uniprot/P42116 P42116] | ||
+ | ** [http://www.uniprot.org/uniprot/P73739 P73739] | ||
+ | ** [http://www.uniprot.org/uniprot/P74614 P74614] | ||
+ | ** [http://www.uniprot.org/uniprot/Q35322 Q35322] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=NADH dehydrogenase}} | ||
+ | {{#set: ec number=EC-1.6.99.3}} | ||
+ | {{#set: gene associated=Ec-02_006350}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:11, 21 March 2018
Contents
Reaction NADH-DEHYDROGENASE-RXN
- direction:
- REVERSIBLE
- common name:
- NADH dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADH[c] + 1 H+[c] + 1 an oxidized unknown electron acceptor[c] <=> 1 NAD+[c] + 1 an reduced unknown electron acceptor[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-02_006350
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: