Difference between revisions of "Ec-10 001700"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * smiles: ** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O...")
(Created page with "Category:Gene == Gene Ec-10_001700 == * left end position: ** 1704276 * transcription direction: ** NEGATIVE * right end position: ** 1718828 * centisome position: ** 26.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+
== Gene Ec-10_001700 ==
−
* smiles:
+
* left end position:
−
** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)
+
** 1704276
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** red chlorophyll catabolite
+
** 1718828
−
* molecular weight:
+
* centisome position:
−
** 624.692    
+
** 26.215658    
 
* Synonym(s):
 
* Synonym(s):
−
** RCC
+
** Esi_0168_0067
−
** red bilin
+
** Esi0168_0067
−
** (7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione
+
** MAN1A1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7741]]
+
* Reaction: [[3.2.1.113-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17253]]
+
*** Assignment: ec-number
−
* [[RXN-7740]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1704276}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820276 91820276]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1718828}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58716 58716]
+
{{#set: centisome position=26.215658   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0168_0067|Esi0168_0067|MAN1A1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C18022 C18022]
+
{{#set: reaction associated=3.2.1.113-RXN}}
−
{{#set: smiles=CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)}}
+
−
{{#set: inchi key=InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M}}
+
−
{{#set: common name=red chlorophyll catabolite}}
+
−
{{#set: molecular weight=624.692   }}
+
−
{{#set: common name=RCC|red bilin|(7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione}}
+
−
{{#set: consumed by=RXN-7741}}
+
−
{{#set: produced by=RXN-17253|RXN-7740}}
+

Latest revision as of 20:11, 21 March 2018

Gene Ec-10_001700

  • left end position:
    • 1704276
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1718828
  • centisome position:
    • 26.215658
  • Synonym(s):
    • Esi_0168_0067
    • Esi0168_0067
    • MAN1A1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_001700&oldid=25161"