Difference between revisions of "Ec-26 004170"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(C...")
(Created page with "Category:Gene == Gene Ec-26_004170 == * left end position: ** 4400253 * transcription direction: ** POSITIVE * right end position: ** 4411255 * centisome position: ** 66.8...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] ==
+
== Gene Ec-26_004170 ==
−
* smiles:
+
* left end position:
−
** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+]
+
** 4400253
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
+
** 4411255
−
* molecular weight:
+
* centisome position:
−
** 586.634    
+
** 66.839134    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP
+
** Esi_0349_0012
−
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione
+
** Esi0349_0012
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPDEPHOS-RXN]]
−
* [[RXN-15681]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-14117]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-14192]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-14207]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[GLYCOLYSIS]]
 +
* [[NPGLUCAT-PWY]]
 +
* [[PWY-7218]]
 +
* [[PWY-7383]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY-5723]]
 +
* [[FERMENTATION-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-5484]]
 +
* [[PWY-6901]]
 +
* [[PWY-6142]]
 +
* [[P122-PWY]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4400253}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657130 90657130]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+]}}
+
{{#set: right end position=4411255}}
−
{{#set: inchi key=InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N}}
+
{{#set: centisome position=66.839134    }}
−
{{#set: common name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common name=Esi_0349_0012|Esi0349_0012}}
−
{{#set: molecular weight=586.634    }}
+
{{#set: reaction associated=PEPDEPHOS-RXN|RXN-14117|RXN-14192|RXN-14207}}
−
{{#set: common name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|GLYCOLYSIS|NPGLUCAT-PWY|PWY-7218|PWY-7383|P124-PWY|PWY-6886|PWY-5723|FERMENTATION-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|PWY-6901|PWY-6142|P122-PWY|PWY-7003}}
−
{{#set: produced by=RXN-15681}}
+

Latest revision as of 20:11, 21 March 2018

Gene Ec-26_004170

  • left end position:
    • 4400253
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4411255
  • centisome position:
    • 66.839134
  • Synonym(s):
    • Esi_0349_0012
    • Esi0349_0012

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_004170&oldid=25195"