Difference between revisions of "ARYLSULFAT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARYLSULFAT-RXN ARYLSULFAT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** sulfuric ester hy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARYLSULFAT-RXN ARYLSULFAT-RXN] ==
−
* smiles:
+
* direction:
−
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** myricetin
+
** sulfuric ester hydrolase
−
* molecular weight:
+
* ec number:
−
** 317.231   
+
** [http://enzyme.expasy.org/EC/3.1.6.1 EC-3.1.6.1]
 
* Synonym(s):
 
* Synonym(s):
−
** myricitin
 
−
** cannabiscetin
 
−
** myricetol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-8450]]
+
** 1 [[Aryl-Sulfate]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Aryl-Alcohol]][c] '''+''' 1 [[SULFATE]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a phenol sulfate[c] '''+''' 1 H2O[c] '''=>''' 1 a phenol[c] '''+''' 1 sulfate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-12_002050]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-07_007630]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-26_004450]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-03_005320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-06_009450]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-03_005310]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-12_005210]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-12_000310]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01243 R01243]
−
* CHEBI:
+
* UNIPROT:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395]
+
** [http://www.uniprot.org/uniprot/P50473 P50473]
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/P20713 P20713]
−
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107]
+
** [http://www.uniprot.org/uniprot/P14217 P14217]
−
* HMDB : HMDB02755
+
** [http://www.uniprot.org/uniprot/P14000 P14000]
−
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}}
+
** [http://www.uniprot.org/uniprot/P25549 P25549]
−
{{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}}
+
** [http://www.uniprot.org/uniprot/P28607 P28607]
−
{{#set: common name=myricetin}}
+
** [http://www.uniprot.org/uniprot/Q10723 Q10723]
−
{{#set: molecular weight=317.231    }}
+
** [http://www.uniprot.org/uniprot/P50474 P50474]
−
{{#set: common name=myricitin|cannabiscetin|myricetol}}
+
** [http://www.uniprot.org/uniprot/Q9X759 Q9X759]
−
{{#set: produced by=RXN-8450}}
+
** [http://www.uniprot.org/uniprot/O43113 O43113]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=sulfuric ester hydrolase}}
 +
{{#set: ec number=EC-3.1.6.1}}
 +
{{#set: gene associated=Ec-12_002050|Ec-07_007630|Ec-26_004450|Ec-03_005320|Ec-06_009450|Ec-03_005310|Ec-12_005210|Ec-12_000310}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:11, 21 March 2018

Reaction ARYLSULFAT-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • sulfuric ester hydrolase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ARYLSULFAT-RXN&oldid=25205"