Difference between revisions of "Ec-01 001290"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENIC_ACID LINOLENIC_ACID] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)[O-] * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-01_001290 == * left end position: ** 1021842 * transcription direction: ** POSITIVE * right end position: ** 1036878 * centisome position: ** 9.90...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_001290 == |
− | * | + | * left end position: |
− | ** | + | ** 1021842 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1036878 |
− | * | + | * centisome position: |
− | ** | + | ** 9.902689 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0151_0014 |
− | ** | + | ** Esi0151_0014 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | + | == Pathways associated == | |
− | * | + | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1021842}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1036878}} | |
− | + | {{#set: centisome position=9.902689 }} | |
− | + | {{#set: common name=Esi_0151_0014|Esi0151_0014}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:11, 21 March 2018
Gene Ec-01_001290
- left end position:
- 1021842
- transcription direction:
- POSITIVE
- right end position:
- 1036878
- centisome position:
- 9.902689
- Synonym(s):
- Esi_0151_0014
- Esi0151_0014
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome