Difference between revisions of "PWY-7218"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * smiles: ** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7218 PWY-7218] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7218 PWY-7218] ==
* smiles:
+
* taxonomic range:
** CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M
+
 
* common name:
 
* common name:
** red chlorophyll catabolite
+
** photosynthetic 3-hydroxybutanoate biosynthesis (engineered)
* molecular weight:
+
** 624.692   
+
 
* Synonym(s):
 
* Synonym(s):
** RCC
+
** photosynthetic 3-hydroxybutyrate biosynthesis (engineered)
** red bilin
+
** (7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-7741]]
+
'''7''' reactions found over '''10''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2PGADEHYDRAT-RXN]]
* [[RXN-17253]]
+
** 3 associated gene(s):
* [[RXN-7740]]
+
*** [[Ec-14_005400]]
== Reaction(s) of unknown directionality ==
+
*** [[Ec-27_004000]]
 +
*** [[Ec-26_004120]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[3PGAREARR-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-27_000330]]
 +
*** [[Ec-24_002670]]
 +
*** [[Ec-10_005410]]
 +
*** [[Ec-03_002160]]
 +
*** [[Ec-03_002170]]
 +
*** [[Ec-01_000980]]
 +
*** [[Ec-06_009930]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[CALVIN-PWY]]
 +
** 0 associated gene:
 +
* [[PEPDEPHOS-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-26_004170]]
 +
*** [[Ec-06_006860]]
 +
*** [[Ec-12_000950]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PWY-101]]
 +
** 0 associated gene:
 +
* [[PWY-7216]]
 +
** 0 associated gene:
 +
* [[PYRUVDEH-RXN]]
 +
** 8 associated gene(s):
 +
*** [[Ec-27_004160]]
 +
*** [[Ec-25_000140]]
 +
*** [[Ec-25_000020]]
 +
*** [[Ec-01_010530]]
 +
*** [[Ec-23_002710]]
 +
*** [[Ec-27_000530]]
 +
*** [[Ec-18_000080]]
 +
*** [[Ec-18_003420]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820276 91820276]
+
{{#set: common name=photosynthetic 3-hydroxybutanoate biosynthesis (engineered)}}
* CHEBI:
+
{{#set: common name=photosynthetic 3-hydroxybutyrate biosynthesis (engineered)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58716 58716]
+
{{#set: reaction found=7}}
* LIGAND-CPD:
+
{{#set: total reaction=10}}
** [http://www.genome.jp/dbget-bin/www_bget?C18022 C18022]
+
{{#set: completion rate=70.0}}
{{#set: smiles=CCC1(C(C)=C(NC=1C=C4(C(C)=C5(C(=O)[C-](C(OC)=O)C(C2(C(CCC(=O)[O-])C(C)C(N=2)=CC3(C(C)=C(C=C)C(=O)N3)))=C(N4)5)))C=O)}}
+
{{#set: inchi key=InChIKey=GVTPYCXGTFQZDT-YSSUGPPCSA-M}}
+
{{#set: common name=red chlorophyll catabolite}}
+
{{#set: molecular weight=624.692    }}
+
{{#set: common name=RCC|red bilin|(7S,8S,101R)-8-(2-carboxyethyl)-17-ethyl-19-formyl-101-(methoxycarbonyl)-3,7,13,18-tetramethyl-2-vinyl-8,23-dihydro-7H-10,12-ethanobiladiene-ab-1,102(21H)-dione}}
+
{{#set: consumed by=RXN-7741}}
+
{{#set: produced by=RXN-17253|RXN-7740}}
+

Latest revision as of 19:12, 21 March 2018

Pathway PWY-7218

  • taxonomic range:
  • common name:
    • photosynthetic 3-hydroxybutanoate biosynthesis (engineered)
  • Synonym(s):
    • photosynthetic 3-hydroxybutyrate biosynthesis (engineered)

Reaction(s) found

7 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links