Difference between revisions of "CPD-591"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7783 PWY-7783] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == |
− | * | + | * smiles: |
− | ** [ | + | ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O) |
+ | * inchi key: | ||
+ | ** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** cyanidin |
+ | * molecular weight: | ||
+ | ** 285.232 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium | ||
+ | ** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium | ||
+ | ** 3,3',4',5,7-pentahydroxyflavylium | ||
+ | ** cyanidol | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-9725]] | |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-602]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905] | ||
+ | * HMDB : HMDB02708 | ||
+ | {{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}} | ||
+ | {{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=cyanidin}} | ||
+ | {{#set: molecular weight=285.232 }} | ||
+ | {{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}} | ||
+ | {{#set: consumed by=RXN-9725}} | ||
+ | {{#set: produced by=RXN-602}} |
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite CPD-591
- smiles:
- C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
- inchi key:
- InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
- common name:
- cyanidin
- molecular weight:
- 285.232
- Synonym(s):
- 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
- 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
- 3,3',4',5,7-pentahydroxyflavylium
- cyanidol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)" cannot be used as a page name in this wiki.