Difference between revisions of "Ec-13 003550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Ec-13_003550 == * left end position: ** 5311524 * transcription direction: ** POSITIVE * right end position: ** 5330032 * centisome position: ** 76.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] ==
+
== Gene Ec-13_003550 ==
−
* smiles:
+
* left end position:
−
** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))
+
** 5311524
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** N'-hydroxymethyl-norcotinine
+
** 5330032
−
* molecular weight:
+
* centisome position:
−
** 192.217    
+
** 76.57612    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0266_0031
 +
** Esi0266_0031
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.6.4.4-RXN]]
−
* [[RXN66-169]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5311524}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201488 25201488]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB01324
+
{{#set: right end position=5330032}}
−
{{#set: smiles=C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))}}
+
{{#set: centisome position=76.57612    }}
−
{{#set: inchi key=InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N}}
+
{{#set: common name=Esi_0266_0031|Esi0266_0031}}
−
{{#set: common name=N'-hydroxymethyl-norcotinine}}
+
{{#set: reaction associated=3.6.4.4-RXN}}
−
{{#set: molecular weight=192.217    }}
+
−
{{#set: produced by=RXN66-169}}
+

Latest revision as of 19:12, 21 March 2018

Gene Ec-13_003550

  • left end position:
    • 5311524
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5330032
  • centisome position:
    • 76.57612
  • Synonym(s):
    • Esi_0266_0031
    • Esi0266_0031

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_003550&oldid=25250"