Difference between revisions of "CPD-17047"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-13_003550 == * left end position: ** 5311524 * transcription direction: ** POSITIVE * right end position: ** 5330032 * centisome position: ** 76.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 586.634 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP |
| − | ** | + | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-15681]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657130 90657130] |
| − | {{#set: | + | {{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}} |
| − | {{#set: | + | {{#set: molecular weight=586.634 }} |
| + | {{#set: common name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione}} | ||
| + | {{#set: produced by=RXN-15681}} | ||
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite CPD-17047
- smiles:
- C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+]
- inchi key:
- InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N
- common name:
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
- molecular weight:
- 586.634
- Synonym(s):
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+" cannot be used as a page name in this wiki.
