Difference between revisions of "5-HYDROXYINDOLE ACETATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-])) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 5-hydroxyindole acetate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 190.178 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-hydroxyindoleacetic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10780]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 54-16-0 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821] |
+ | * HMDB : HMDB00763 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622] |
− | {{#set: smiles= | + | {{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}} |
− | {{#set: common name= | + | {{#set: common name=5-hydroxyindole acetate}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=190.178 }} |
− | {{#set: common name= | + | {{#set: common name=5-hydroxyindoleacetic acid}} |
− | + | {{#set: produced by=RXN-10780}} | |
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite 5-HYDROXYINDOLE_ACETATE
- smiles:
- C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
- inchi key:
- InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
- common name:
- 5-hydroxyindole acetate
- molecular weight:
- 190.178
- Synonym(s):
- 5-hydroxyindoleacetic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))" cannot be used as a page name in this wiki.