Difference between revisions of "MYRICETIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN3-RXN THIAZOLSYN3-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-methyl-5(b-hy...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN3-RXN THIAZOLSYN3-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
 +
* inchi key:
 +
** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** 4-methyl-5(b-hydroxyethyl)-thiazole monophosphate biosynthesis protein, putative
+
** myricetin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.1.50 EC-2.7.1.50]
+
** 317.231   
 
* Synonym(s):
 
* Synonym(s):
 +
** myricitin
 +
** cannabiscetin
 +
** myricetol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[THZ]][c] '''=>''' 1 [[THZ-P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
+
* [[RXN-8450]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 5-(2-hydroxyethyl)-4-methylthiazole[c] '''=>''' 1 4-methyl-5-(2-phosphooxyethyl)thiazole[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_008860]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-6897]], thiamine salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897]
+
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7356]], thiamine salvage IV (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356]
+
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7357]], thiamine formation from pyrithiamine and oxythiamine (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7357 PWY-7357]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24212 24212]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04448 R04448]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P41835 P41835]
+
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107]
−
** [http://www.uniprot.org/uniprot/O28204 O28204]
+
* HMDB : HMDB02755
−
** [http://www.uniprot.org/uniprot/P76423 P76423]
+
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}}
−
** [http://www.uniprot.org/uniprot/Q57233 Q57233]
+
{{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/Q9CG46 Q9CG46]
+
{{#set: common name=myricetin}}
−
** [http://www.uniprot.org/uniprot/P39593 P39593]
+
{{#set: molecular weight=317.231    }}
−
** [http://www.uniprot.org/uniprot/P40386 P40386]
+
{{#set: common name=myricitin|cannabiscetin|myricetol}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: produced by=RXN-8450}}
−
{{#set: common name=4-methyl-5(b-hydroxyethyl)-thiazole monophosphate biosynthesis protein, putative}}
+
−
{{#set: ec number=EC-2.7.1.50}}
+
−
{{#set: gene associated=Ec-01_008860}}
+
−
{{#set: in pathway=PWY-6897|PWY-7356|PWY-7357}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:12, 21 March 2018

Metabolite MYRICETIN

  • smiles:
    • C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
  • inchi key:
    • InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
  • common name:
    • myricetin
  • molecular weight:
    • 317.231
  • Synonym(s):
    • myricitin
    • cannabiscetin
    • myricetol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=MYRICETIN&oldid=25266"