Difference between revisions of "MYRICETIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-04_001540 == * left end position: ** 1797271 * transcription direction: ** POSITIVE * right end position: ** 1802165 * centisome position: ** 27.6...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-04_001540 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] ==
* left end position:
+
* smiles:
** 1797271
+
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
* right end position:
+
* common name:
** 1802165
+
** myricetin
* centisome position:
+
* molecular weight:
** 27.600002    
+
** 317.231    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0015_0151
+
** myricitin
** Esi0015_0151
+
** cannabiscetin
** RluD
+
** myricetol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[RXN-11838]]
+
== Reaction(s) known to produce the compound ==
** Source: [[annotation-esiliculosus_genome]]
+
* [[RXN-8450]]
*** Assignment: automated-name-match
+
== Reaction(s) of unknown directionality ==
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: go-term
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1797271}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643]
{{#set: right end position=1802165}}
+
* CHEBI:
{{#set: centisome position=27.600002   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395]
{{#set: common name=Esi_0015_0151|Esi0015_0151|RluD}}
+
* LIGAND-CPD:
{{#set: reaction associated=RXN-11838|TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107]
 +
* HMDB : HMDB02755
 +
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}}
 +
{{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}}
 +
{{#set: common name=myricetin}}
 +
{{#set: molecular weight=317.231   }}
 +
{{#set: common name=myricitin|cannabiscetin|myricetol}}
 +
{{#set: produced by=RXN-8450}}

Latest revision as of 19:12, 21 March 2018

Metabolite MYRICETIN

  • smiles:
    • C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
  • inchi key:
    • InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
  • common name:
    • myricetin
  • molecular weight:
    • 317.231
  • Synonym(s):
    • myricitin
    • cannabiscetin
    • myricetol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))" cannot be used as a page name in this wiki.