Difference between revisions of "PWY-6722"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6722 PWY-6722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-18...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6722 PWY-6722] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-1883] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** candicidin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''6''' reactions in the full pathway | |
| − | * [[ | + | * [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] |
| − | == Reaction(s) | + | ** 7 associated gene(s): |
| + | *** [[Ec-19_003040]] | ||
| + | *** [[Ec-03_001890]] | ||
| + | *** [[Ec-14_002460]] | ||
| + | *** [[Ec-01_009720]] | ||
| + | *** [[Ec-01_010970]] | ||
| + | *** [[Ec-19_003230]] | ||
| + | *** [[Ec-20_002520]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12161 RXN-12161] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12162 RXN-12162] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15954 RXN-15954] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15971 RXN-15971] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15975 RXN-15975] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1883}} | |
| − | + | {{#set: common name=candicidin biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=6}} |
| − | {{#set: | + | {{#set: completion rate=17.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:12, 21 March 2018
Pathway PWY-6722
- taxonomic range:
- common name:
- candicidin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- ACETYL-COA-CARBOXYLTRANSFER-RXN
- 7 associated gene(s):
- 2 reconstruction source(s) associated:
