Difference between revisions of "PWY-5034"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17047 CPD-17047] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034] ==
−
* smiles:
+
* taxonomic range:
−
** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N
+
 
* common name:
 
* common name:
−
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
+
** GA12 biosynthesis
−
* molecular weight:
+
−
** 586.634   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP
+
** gibberellin A12 biosynthesis
−
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''6''' reactions in the full pathway
−
* [[RXN-15681]]
+
* [[1.14.13.79-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-00_005820]]
 +
*** [[Ec-10_006240]]
 +
*** [[Ec-00_005850]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN1F-160]]
 +
** 3 associated gene(s):
 +
*** [[Ec-10_006240]]
 +
*** [[Ec-00_005850]]
 +
*** [[Ec-00_005820]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN1F-161]]
 +
** 3 associated gene(s):
 +
*** [[Ec-00_005820]]
 +
*** [[Ec-10_006240]]
 +
*** [[Ec-00_005850]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.14.13.78-RXN 1.14.13.78-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5242 RXN-5242]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657130 90657130]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5034 PWY-5034]
−
{{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)[N+])(CO)NC(=O)2))C(C(NCC([O-])=O)=O)[N+]}}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: inchi key=InChIKey=CHBULTTUDAIWDP-HCIHMXRSSA-N}}
+
{{#set: common name=GA12 biosynthesis}}
−
{{#set: common name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common name=gibberellin A12 biosynthesis}}
−
{{#set: molecular weight=586.634    }}
+
{{#set: reaction found=3}}
−
{{#set: common name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: total reaction=6}}
−
{{#set: produced by=RXN-15681}}
+
{{#set: completion rate=50.0}}

Latest revision as of 19:12, 21 March 2018

Pathway PWY-5034

  • taxonomic range:
  • common name:
    • GA12 biosynthesis
  • Synonym(s):
    • gibberellin A12 biosynthesis

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5034&oldid=25278"