Difference between revisions of "Ec-26 004450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S * inchi key: **...")
(Created page with "Category:Gene == Gene Ec-26_004450 == * left end position: ** 4656198 * transcription direction: ** POSITIVE * right end position: ** 4666957 * centisome position: ** 70.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] ==
+
== Gene Ec-26_004450 ==
−
* smiles:
+
* left end position:
−
** CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S
+
** 4656198
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LCCNCVORNKJIRZ-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** parathion
+
** 4666957
−
* molecular weight:
+
* centisome position:
−
** 291.258    
+
** 70.7269    
 
* Synonym(s):
 
* Synonym(s):
−
** ethyl parathion
+
** Esi_0280_0019
−
** parthion
+
** Esi0280_0019
−
** alkron
+
−
** Paraphos
+
−
** Foliclal
+
−
** Fosferno
+
−
** Fostox
+
−
** Rhodiatox
+
−
** O,O-diethyl O-p-nitrophenyl phosphorothioate
+
−
** diethyl-p-nitrophenyl monothiophosphate
+
−
** DNTP
+
−
** Alleron
+
−
** Aphamite
+
−
** Etilon
+
−
** Folidol
+
−
** Phoskil
+
−
** Parathion-E
+
−
** Aqua 9-Parathion
+
−
** Bladen
+
−
** phosphorothioic acid O,O-diethyl-O-(4-nitrophenyl) ester
+
−
** diethyl p-nitrophenyl thiophosphate
+
−
** O,O-diethyl-O-(p-nitrophenyl)thionophosphate
+
−
** diethylparathion
+
−
** p-nitrophenol O-ester with O,O-diethylphosphorothioate
+
−
** AATP
+
−
** acc 3422
+
−
** american cyanamid 3422
+
−
** Aralo
+
−
** bayer e-605
+
−
** bladan f
+
−
** corothion
+
−
** corthione
+
−
** danthion
+
−
** ecatox
+
−
** fosfive
+
−
** fosova
+
−
** fostern
+
−
** genithion
+
−
** kolphos
+
−
** kypthion
+
−
** lirothion
+
−
** murfos
+
−
** nitrostygmine
+
−
** niuif-100
+
−
** nourithion
+
−
** oleofos 20
+
−
** oleoparathion
+
−
** Orthophos
+
−
** panthion
+
−
** Paramar
+
−
** paramar 50
+
−
** parathene
+
−
** Parawet
+
−
** pestox plus
+
−
** pethion
+
−
** phosphemol
+
−
** phosphenol
+
−
** phosphostigmine
+
−
** stathion
+
−
** strathion
+
−
** sulfos
+
−
** thiophos 3422
+
−
** vapophos
+
−
** diethyl para-nitrophenol thiophosphate
+
−
** diethyl 4-nitrophenyl phosphorothionate
+
−
** diethyl p-nitrophenyl thionophosphate
+
−
** drexel parathion 8E
+
−
** E 605 F
+
−
** e 605 forte
+
−
** ekatox
+
−
** ethlon
+
−
** folidol e605
+
−
** folidol oil
+
−
** fosfermo
+
−
** fosfex
+
−
** gearphos
+
−
** lethalaire g-54
+
−
** oleoparaphene
+
−
** Paradust
+
−
** rhodiasol
+
−
** rhodiatrox
+
−
** selephos
+
−
** soprathion
+
−
** super rodiatox
+
−
** vitrex
+
−
** penncap e
+
−
** thiomex
+
−
** tiofos
+
−
** Viran
+
−
** Durathion
+
−
** Thionspray No.84
+
−
** Bladan
+
−
** Diethyl O-p-nitrophenyl phosphorothioate
+
−
** Fosferno 50
+
−
** Niran
+
−
** Ethyl parathion (O,O-diethyl-O-p-nitrophenylthiophosphate)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
+
* Reaction: [[ARYLSULFAT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 56-38-2
+
{{#set: left end position=4656198}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=991 991]
+
{{#set: right end position=4666957}}
−
* HMDB : HMDB01355
+
{{#set: centisome position=70.7269   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0280_0019|Esi0280_0019}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06604 C06604]
+
{{#set: reaction associated=ARYLSULFAT-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13844817.html 13844817]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27928 27928]
+
−
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+](=O)[O-]))(OCC)=S}}
+
−
{{#set: inchi key=InChIKey=LCCNCVORNKJIRZ-UHFFFAOYSA-N}}
+
−
{{#set: common name=parathion}}
+
−
{{#set: molecular weight=291.258   }}
+
−
{{#set: common name=ethyl parathion|parthion|alkron|Paraphos|Foliclal|Fosferno|Fostox|Rhodiatox|O,O-diethyl O-p-nitrophenyl phosphorothioate|diethyl-p-nitrophenyl monothiophosphate|DNTP|Alleron|Aphamite|Etilon|Folidol|Phoskil|Parathion-E|Aqua 9-Parathion|Bladen|phosphorothioic acid O,O-diethyl-O-(4-nitrophenyl) ester|diethyl p-nitrophenyl thiophosphate|O,O-diethyl-O-(p-nitrophenyl)thionophosphate|diethylparathion|p-nitrophenol O-ester with O,O-diethylphosphorothioate|AATP|acc 3422|american cyanamid 3422|Aralo|bayer e-605|bladan f|corothion|corthione|danthion|ecatox|fosfive|fosova|fostern|genithion|kolphos|kypthion|lirothion|murfos|nitrostygmine|niuif-100|nourithion|oleofos 20|oleoparathion|Orthophos|panthion|Paramar|paramar 50|parathene|Parawet|pestox plus|pethion|phosphemol|phosphenol|phosphostigmine|stathion|strathion|sulfos|thiophos 3422|vapophos|diethyl para-nitrophenol thiophosphate|diethyl 4-nitrophenyl phosphorothionate|diethyl p-nitrophenyl thionophosphate|drexel parathion 8E|E 605 F|e 605 forte|ekatox|ethlon|folidol e605|folidol oil|fosfermo|fosfex|gearphos|lethalaire g-54|oleoparaphene|Paradust|rhodiasol|rhodiatrox|selephos|soprathion|super rodiatox|vitrex|penncap e|thiomex|tiofos|Viran|Durathion|Thionspray No.84|Bladan|Diethyl O-p-nitrophenyl phosphorothioate|Fosferno 50|Niran|Ethyl parathion (O,O-diethyl-O-p-nitrophenylthiophosphate)}}
+
−
{{#set: consumed by=ARYLDIALKYL-PHOSPHATASE-RXN}}
+

Latest revision as of 19:12, 21 March 2018

Gene Ec-26_004450

  • left end position:
    • 4656198
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4666957
  • centisome position:
    • 70.7269
  • Synonym(s):
    • Esi_0280_0019
    • Esi0280_0019

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_004450&oldid=25300"