Difference between revisions of "GLUTSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUTSYN-PWY GLUTSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUTSYN-PWY GLUTSYN-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
* common name: | * common name: | ||
| − | ** | + | ** L-glutamate biosynthesis I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
| − | * [[ | + | * [[GLUTAMATESYN-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Ec-26_004630]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLUTSYN-PWY GLUTSYN-PWY] |
| − | {{#set: | + | {{#set: taxonomic range=TAX-33090}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-4751}} |
| − | {{#set: common name= | + | {{#set: taxonomic range=TAX-2}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2157}} |
| − | {{#set: | + | {{#set: common name=L-glutamate biosynthesis I}} |
| − | {{#set: | + | {{#set: reaction found=1}} |
| + | {{#set: total reaction=1}} | ||
| + | {{#set: completion rate=100.0}} | ||
Latest revision as of 20:12, 21 March 2018
Pathway GLUTSYN-PWY
- taxonomic range:
- common name:
- L-glutamate biosynthesis I
- Synonym(s):
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- GLUTAMATESYN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
