Difference between revisions of "CPD-17050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-475...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
−
** gluconeogenesis I
+
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
 +
* molecular weight:
 +
** 296.358   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''13''' reactions found over '''13''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[1.1.1.39-RXN]]
+
* [[RXN-15684]]
−
** 3 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-01_003680]]
+
−
*** [[Ec-07_002070]]
+
−
*** [[Ec-07_002060]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[2PGADEHYDRAT-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-27_004000]]
+
−
*** [[Ec-26_004120]]
+
−
*** [[Ec-14_005400]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[3PGAREARR-RXN]]
+
−
** 7 associated gene(s):
+
−
*** [[Ec-24_002670]]
+
−
*** [[Ec-03_002170]]
+
−
*** [[Ec-27_000330]]
+
−
*** [[Ec-03_002160]]
+
−
*** [[Ec-01_000980]]
+
−
*** [[Ec-06_009930]]
+
−
*** [[Ec-10_005410]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[F16ALDOLASE-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-10_000880]]
+
−
*** [[Ec-10_004980]]
+
−
*** [[Ec-14_001680]]
+
−
*** [[Ec-01_008040]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[F16BDEPHOS-RXN]]
+
−
** 7 associated gene(s):
+
−
*** [[Ec-12_004070]]
+
−
*** [[Ec-04_004710]]
+
−
*** [[Ec-14_005760]]
+
−
*** [[Ec-06_004200]]
+
−
*** [[Ec-17_003090]]
+
−
*** [[Ec-21_001790]]
+
−
*** [[Ec-22_000360]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[GAPOXNPHOSPHN-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-25_003550]]
+
−
*** [[Ec-19_001850]]
+
−
*** [[Ec-19_003020]]
+
−
*** [[Ec-08_000500]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[MALATE-DEH-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Ec-10_006200]]
+
−
*** [[Ec-02_003100]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[MALIC-NADP-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_003680]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[PEPCARBOXYKIN-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-19_002930]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[PEPSYNTH-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PGLUCISOM-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-24_002470]]
+
−
*** [[Ec-13_003530]]
+
−
*** [[Ec-13_003810]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PHOSGLYPHOS-RXN]]
+
−
** 6 associated gene(s):
+
−
*** [[Ec-12_004530]]
+
−
*** [[Ec-01_001350]]
+
−
*** [[Ec-08_002400]]
+
−
*** [[Ec-12_004550]]
+
−
*** [[Ec-21_005710]]
+
−
*** [[Ec-21_004220]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[TRIOSEPISOMERIZATION-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-08_000500]]
+
−
*** [[Ec-23_004160]]
+
−
*** [[Ec-03_002790]]
+
−
*** [[Ec-24_000360]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891]
−
* ARACYC:
+
{{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}}
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
+
{{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}}
−
{{#set: taxonomic range=TAX-4751}}
+
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
−
{{#set: taxonomic range=TAX-33090}}
+
{{#set: molecular weight=296.358    }}
−
{{#set: taxonomic range=TAX-2157}}
+
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}}
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: produced by=RXN-15684}}
−
{{#set: common name=gluconeogenesis I}}
+
−
{{#set: reaction found=13}}
+
−
{{#set: total reaction=13}}
+
−
{{#set: completion rate=100.0}}
+

Latest revision as of 20:12, 21 March 2018

Metabolite CPD-17050

  • smiles:
    • C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
  • inchi key:
    • InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 296.358
  • Synonym(s):
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-17050&oldid=25319"