Difference between revisions of "Aliphatic-Amines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aliphatic-Amines Aliphatic-Amines] == * common name: ** an aliphatic amine * Synonym(s): ** RCH...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aliphatic-Amines Aliphatic-Amines] ==
* smiles:
+
** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
+
* inchi key:
+
** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
+
 
* common name:
 
* common name:
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** an aliphatic amine
* molecular weight:
+
** 296.358   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
+
** RCH2NH2
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
+
** RCH(2)NH(2)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AMINEOXID-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15684]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an aliphatic amine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891]
+
{{#set: common name=RCH2NH2|RCH(2)NH(2)}}
{{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}}
+
{{#set: consumed by=AMINEOXID-RXN}}
{{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}}
+
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: molecular weight=296.358    }}
+
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: produced by=RXN-15684}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite Aliphatic-Amines

  • common name:
    • an aliphatic amine
  • Synonym(s):
    • RCH2NH2
    • RCH(2)NH(2)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links