Difference between revisions of "RXN0-4961"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4961 RXN0-4961] == * direction: ** LEFT-TO-RIGHT * common name: ** DNA polymerase, palm domain...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4961 RXN0-4961] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** DNA polymerase, palm domain |
| − | * | + | ** DNA polymerase subunit Cdc27 |
| − | ** | + | * ec number: |
| + | ** [http://enzyme.expasy.org/EC/3.1.11 EC-3.1.11] | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** n [[WATER]][c] '''+''' 1 [[DNA-N]][c] '''=>''' n [[Nucleoside-Monophosphates]][c] |
| − | == | + | * With common name(s): |
| + | ** n H2O[c] '''+''' 1 DNAn[c] '''=>''' n a nucleoside 5'-monophosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-08_004310]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[Ec-10_001440]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=DNA polymerase, palm domain}} | |
| − | {{#set: | + | {{#set: common name=DNA polymerase subunit Cdc27}} |
| − | {{#set: | + | {{#set: ec number=EC-3.1.11}} |
| − | {{#set: | + | {{#set: gene associated=Ec-08_004310|Ec-10_001440}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
| + | {{#set: reconstruction tool=pathwaytools}} | ||
Latest revision as of 19:13, 21 March 2018
Contents
Reaction RXN0-4961
- direction:
- LEFT-TO-RIGHT
- common name:
- DNA polymerase, palm domain
- DNA polymerase subunit Cdc27
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- n WATER[c] + 1 DNA-N[c] => n Nucleoside-Monophosphates[c]
- With common name(s):
- n H2O[c] + 1 DNAn[c] => n a nucleoside 5'-monophosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-08_004310
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-10_001440
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
