Difference between revisions of "RXN-16130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16130 RXN-16130] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16130 RXN-16130] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CPD-17382]][c] '''=>''' 1 [[CPD-17383]][c] '''+''' 1 [[WATER]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 (3R)-hydroxy-tetracosapentaenoyl-CoA[c] '''=>''' 1 (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA[c] '''+''' 1 H2O[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606] | ||
| + | ** '''14''' reactions found over '''14''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-4.2.1.134}} | |
| − | + | {{#set: in pathway=PWY-7606}} | |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:13, 21 March 2018
Contents
Reaction RXN-16130
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 (3R)-hydroxy-tetracosapentaenoyl-CoA[c] => 1 (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA[c] + 1 H2O[c]
Genes associated with this reaction
Pathways
- PWY-7606, docosahexaenoate biosynthesis III (6-desaturase, mammals): PWY-7606
- 14 reactions found over 14 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
