Difference between revisions of "RXN-4733"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] == * smiles: ** C(=O)([O-])CNC(=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4733 RXN-4733] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-24-DINITROPHENYLGLUTATHIONE S-24-DINITROPHENYLGLUTATHIONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4733 RXN-4733] ==
* smiles:
+
* direction:
** C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M
+
** [http://enzyme.expasy.org/EC/2.4.1 EC-2.4.1]
* common name:
+
** 2,4-dinitrophenyl-S-glutathione
+
* molecular weight:
+
** 472.406   
+
 
* Synonym(s):
 
* Synonym(s):
** DNP-SG
 
** S-(2,4-dinitrophenyl)glutathione
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-4441]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c] '''+''' 1 [[CPD-4618]][c]
* [[GST-RXN]]
+
* With common name(s):
 +
** 1 cis-zeatin[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 H+[c] '''+''' 1 UDP[c] '''+''' 1 cis-zeatin-7-N-glucoside[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-14_000870]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-04_004610]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-2881]], cytokinins 7-N-glucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2881 PWY-2881]
 +
** '''1''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25322932 25322932]
+
{{#set: ec number=EC-2.4.1}}
* CHEBI:
+
{{#set: gene associated=Ec-14_000870|Ec-04_004610}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8927 8927]
+
{{#set: in pathway=PWY-2881}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C11175 C11175]
+
{{#set: reconstruction source=orthology-aragem}}
{{#set: smiles=C(=O)([O-])CNC(=O)C(NC(=O)CCC([N+])C(=O)[O-])CSC1(C=CC([N+]([O-])=O)=CC([N+]([O-])=O)=1)}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=FXEUKVKGTKDDIQ-UWVGGRQHSA-M}}
+
{{#set: common name=2,4-dinitrophenyl-S-glutathione}}
+
{{#set: molecular weight=472.406    }}
+
{{#set: common name=DNP-SG|S-(2,4-dinitrophenyl)glutathione}}
+
{{#set: consumed or produced by=GST-RXN}}
+

Latest revision as of 20:13, 21 March 2018

Reaction RXN-4733

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 cis-zeatin[c] + 1 UDP-α-D-glucose[c] => 1 H+[c] + 1 UDP[c] + 1 cis-zeatin-7-N-glucoside[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2881, cytokinins 7-N-glucoside biosynthesis: PWY-2881
    • 1 reactions found over 7 reactions in the full pathway

Reconstruction information

External links