Difference between revisions of "LysW-L-glutamate-5-semialdehyde"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=HEBKCHPVOIAQTA-ZXF...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate-5-semialdehyde LysW-L-glutamate-5-semialdehyde] == * common name: ** an [L-2-a...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate-5-semialdehyde LysW-L-glutamate-5-semialdehyde] ==
−
* smiles:
+
−
** C(O)C(O)C(O)C(O)CO
+
−
* inchi key:
+
−
** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
+
 
* common name:
 
* common name:
−
** ribitol
+
** an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde
−
* molecular weight:
+
−
** 152.147   
+
 
* Synonym(s):
 
* Synonym(s):
−
** meso-ribitol
+
** a [LysW protein]-L-glutamate 5-semialdehyde
−
** adonitol
+
** an [α-aminoadipate carrier protein]-L-glutamate 5-semialdehyde
−
** (2R,3s,4S)-pentane-1,2,3,4,5-pentol
+
−
** D-ribitol
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15006]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
* [[RXN-15007]]
 
== External links  ==
 
== External links  ==
−
* CAS : 488-81-3
+
{{#set: common name=an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde}}
−
* LIGAND-CPD:
+
{{#set: common name=a [LysW protein]-L-glutamate 5-semialdehyde|an [α-aminoadipate carrier protein]-L-glutamate 5-semialdehyde}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474]
+
{{#set: produced by=RXN-15006}}
−
* CHEBI:
+
{{#set: reversible reaction associated=RXN-15007}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963]
+
−
* METABOLIGHTS : MTBLC15963
+
−
* HMDB : HMDB00508
+
−
{{#set: smiles=C(O)C(O)C(O)C(O)CO}}
+
−
{{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}}
+
−
{{#set: common name=ribitol}}
+
−
{{#set: molecular weight=152.147    }}
+
−
{{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|D-ribitol}}
+
−
{{#set: reversible reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:13, 21 March 2018

Metabolite LysW-L-glutamate-5-semialdehyde

  • common name:
    • an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde
  • Synonym(s):
    • a [LysW protein]-L-glutamate 5-semialdehyde
    • an [α-aminoadipate carrier protein]-L-glutamate 5-semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde" cannot be used as a page name in this wiki.
  • "a [LysW protein]-L-glutamate 5-semialdehyde" cannot be used as a page name in this wiki.
  • "an [α-aminoadipate carrier protein]-L-glutamate 5-semialdehyde" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=LysW-L-glutamate-5-semialdehyde&oldid=25425"