Difference between revisions of "RXN-16138"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTIDINE-5-PHOSPHATE OROTIDINE-5-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16138 RXN-16138] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 * ec numbe...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTIDINE-5-PHOSPHATE OROTIDINE-5-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16138 RXN-16138] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C(C(=O)[O-])=CC(=O)NC(=O)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KYOBSHFOBAOFBF-XVFCMESISA-K
+
 
* common name:
 
* common name:
−
** orotidine 5'-phosphate
+
** phospholipase A2
−
* molecular weight:
+
* ec number:
−
** 365.17   
+
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[OROTPDECARB-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17355]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-10244]][c] '''+''' 1 [[Glycerolipids]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[OROPRIBTRANS-RXN]]
+
** 1 a [glycerolipid]-docosahexaenoate[c] '''+''' 1 H2O[c] '''=>''' 1 docosahexaenoate[c] '''+''' 1 a glycerolipid[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-04_004650]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-21_005150]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY66-397]], resolvin D biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-397 PWY66-397]
 +
** '''1''' reactions found over '''11''' reactions in the full pathway
 +
* [[PWY66-395]], aspirin triggered resolvin D biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-395 PWY66-395]
 +
** '''1''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2149-82-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 36813
+
{{#set: common name=phospholipase A2}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.1.1.4}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878393 46878393]
+
{{#set: gene associated=Ec-04_004650|Ec-21_005150}}
−
* HMDB : HMDB00218
+
{{#set: in pathway=PWY66-397|PWY66-395}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01103 C01103]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57538 57538]
+
−
* METABOLIGHTS : MTBLC57538
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C(C(=O)[O-])=CC(=O)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=KYOBSHFOBAOFBF-XVFCMESISA-K}}
+
−
{{#set: common name=orotidine 5'-phosphate}}
+
−
{{#set: molecular weight=365.17    }}
+
−
{{#set: consumed by=OROTPDECARB-RXN}}
+
−
{{#set: reversible reaction associated=OROPRIBTRANS-RXN}}
+

Latest revision as of 20:14, 21 March 2018

Reaction RXN-16138

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phospholipase A2
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a [glycerolipid]-docosahexaenoate[c] + 1 H2O[c] => 1 docosahexaenoate[c] + 1 a glycerolipid[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-397, resolvin D biosynthesis: PWY66-397
    • 1 reactions found over 11 reactions in the full pathway
  • PWY66-395, aspirin triggered resolvin D biosynthesis: PWY66-395
    • 1 reactions found over 11 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-16138&oldid=25494"