Difference between revisions of "Ec-20 001900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=...")
 
(Created page with "Category:Gene == Gene Ec-20_001900 == * left end position: ** 1868761 * transcription direction: ** NEGATIVE * right end position: ** 1873687 * centisome position: ** 36.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] ==
+
== Gene Ec-20_001900 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1868761
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 18-hydroxylinoleoyl-CoA
+
** 1873687
−
* molecular weight:
+
* centisome position:
−
** 1041.936    
+
** 36.241436    
 
* Synonym(s):
 
* Synonym(s):
−
** ω-hydroxylinoleoyl-CoA
+
** Esi_0023_0089
 +
** Esi0023_0089
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16118]]
+
* Reaction: [[RXN0-5419]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1868761}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659898 90659898]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1873687}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84904 84904]
+
{{#set: centisome position=36.241436   }}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0023_0089|Esi0023_0089}}
−
{{#set: inchi key=InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J}}
+
{{#set: reaction associated=RXN0-5419}}
−
{{#set: common name=18-hydroxylinoleoyl-CoA}}
+
−
{{#set: molecular weight=1041.936   }}
+
−
{{#set: common name=ω-hydroxylinoleoyl-CoA}}
+
−
{{#set: consumed by=RXN-16118}}
+

Latest revision as of 19:14, 21 March 2018

Gene Ec-20_001900

  • left end position:
    • 1868761
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1873687
  • centisome position:
    • 36.241436
  • Synonym(s):
    • Esi_0023_0089
    • Esi0023_0089

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_001900&oldid=25500"