Difference between revisions of "CPD-17045"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16761 RXN-16761] == * direction: ** REVERSIBLE * common name: ** Dolichyl-diphosphooligosacchar...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) |
+ | * inchi key: | ||
+ | ** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine |
− | + | * molecular weight: | |
− | * | + | ** 266.253 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP | ||
+ | ** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-15680]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074] |
− | {{#set: common name= | + | {{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}} |
− | + | {{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}} | |
− | {{#set: common name= | + | {{#set: molecular weight=266.253 }} |
− | + | {{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}} | |
− | + | {{#set: consumed by=RXN-15680}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite CPD-17045
- smiles:
- C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
- inchi key:
- InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
- common name:
- 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
- molecular weight:
- 266.253
- Synonym(s):
- 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
- 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: