Difference between revisions of "Ec-14 001390"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-14_001390 == * left end position: ** 1345768 * transcription direction: ** NEGATIVE * right end position: ** 1354730 * centisome position: ** 20.5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-14_001390 == |
− | * | + | * left end position: |
− | ** | + | ** 1345768 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1354730 |
− | * | + | * centisome position: |
− | ** | + | ** 20.513418 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0182_0038 |
− | ** | + | ** Esi0182_0038 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1345768}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=1354730}} |
− | {{#set: | + | {{#set: centisome position=20.513418 }} |
− | {{#set: | + | {{#set: common name=Esi_0182_0038|Esi0182_0038}} |
− | {{#set: | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Gene Ec-14_001390
- left end position:
- 1345768
- transcription direction:
- NEGATIVE
- right end position:
- 1354730
- centisome position:
- 20.513418
- Synonym(s):
- Esi_0182_0038
- Esi0182_0038
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome