Difference between revisions of "PWY66-368"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * inchi key: ** InChIKey=CVSVTCORW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7711 TAX-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-368 PWY66-368] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7711 TAX-7711] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ketolysis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ketone body metabolism |
| − | ** | + | ** ketone body degradation |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] | |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| − | * [ | + | *** [[Ec-26_003940]] |
| + | *** [[Ec-24_000870]] | ||
| + | *** [[Ec-22_002850]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN 3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXNI-2 RXNI-2] | ||
== External links == | == External links == | ||
| − | * | + | * REACTOME : REACT_59 |
| − | + | {{#set: taxonomic range=TAX-7711}} | |
| − | + | {{#set: common name=ketolysis}} | |
| − | + | {{#set: common name=ketone body metabolism|ketone body degradation}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:14, 21 March 2018
Pathway PWY66-368
- taxonomic range:
- common name:
- ketolysis
- Synonym(s):
- ketone body metabolism
- ketone body degradation
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- REACTOME : REACT_59
