Difference between revisions of "PWY-7126"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7126 PWY-7126] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4890 TAX-48...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7126 PWY-7126] ==
* smiles:
+
* taxonomic range:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4890 TAX-4890]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
** InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J
+
 
* common name:
 
* common name:
** 18-hydroxylinoleoyl-CoA
+
** ethylene biosynthesis IV (engineered)
* molecular weight:
+
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
** ω-hydroxylinoleoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16118]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-12_008040]]
 +
*** [[Ec-06_008240]]
 +
*** [[Ec-06_001980]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12538 RXN-12538]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13396 RXN-13396]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4890}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659898 90659898]
+
{{#set: taxonomic range=TAX-1224}}
* CHEBI:
+
{{#set: common name=ethylene biosynthesis IV (engineered)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84904 84904]
+
{{#set: reaction found=1}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: total reaction=3}}
{{#set: inchi key=InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J}}
+
{{#set: completion rate=33.0}}
{{#set: common name=18-hydroxylinoleoyl-CoA}}
+
{{#set: molecular weight=1041.936    }}
+
{{#set: common name=ω-hydroxylinoleoyl-CoA}}
+
{{#set: consumed by=RXN-16118}}
+

Latest revision as of 19:14, 21 March 2018

Pathway PWY-7126

  • taxonomic range:
  • common name:
    • ethylene biosynthesis IV (engineered)
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links