Difference between revisions of "NIACINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17641 CPD-17641] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCCCCCCCCCCCO)COP(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINE NIACINE] == * smiles: ** C1(=CC=C(C([O-])=O)C=N1) * inchi key: ** InChIKey=PVNIIMVLHYAW...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINE NIACINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(=CC=C(C([O-])=O)C=N1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PVNIIMVLHYAWGP-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** nicotinate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 122.103 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-pyridinecarboxylic acid |
| − | ** | + | ** nicotinic acid |
| − | ** | + | ** wampocap |
| + | ** nicolar | ||
| + | ** nicocap | ||
| + | ** nicobid | ||
| + | ** nico-400- | ||
| + | ** nicamin | ||
| + | ** niacin | ||
| + | ** niacine | ||
| + | ** vitamin B3 | ||
| + | ** 3-pyridinecarboxylate | ||
| + | ** pyridine-3-carboxylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[NICOTINATEPRIBOSYLTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 59-67-6 | ||
| + | * BIGG : 34401 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=937 937] |
| − | {{#set: smiles= | + | * HMDB : HMDB01488 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00253 C00253] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.912.html 912] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32544 32544] | ||
| + | * METABOLIGHTS : MTBLC32544 | ||
| + | {{#set: smiles=C1(=CC=C(C([O-])=O)C=N1)}} | ||
| + | {{#set: inchi key=InChIKey=PVNIIMVLHYAWGP-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=nicotinate}} | ||
| + | {{#set: molecular weight=122.103 }} | ||
| + | {{#set: common name=3-pyridinecarboxylic acid|nicotinic acid|wampocap|nicolar|nicocap|nicobid|nico-400-|nicamin|niacin|niacine|vitamin B3|3-pyridinecarboxylate|pyridine-3-carboxylate}} | ||
| + | {{#set: consumed by=NICOTINATEPRIBOSYLTRANS-RXN}} | ||
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite NIACINE
- smiles:
- C1(=CC=C(C([O-])=O)C=N1)
- inchi key:
- InChIKey=PVNIIMVLHYAWGP-UHFFFAOYSA-M
- common name:
- nicotinate
- molecular weight:
- 122.103
- Synonym(s):
- 3-pyridinecarboxylic acid
- nicotinic acid
- wampocap
- nicolar
- nicocap
- nicobid
- nico-400-
- nicamin
- niacin
- niacine
- vitamin B3
- 3-pyridinecarboxylate
- pyridine-3-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 59-67-6
- BIGG : 34401
- PUBCHEM:
- HMDB : HMDB01488
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC32544
"C1(=CC=C(C([O-])=O)C=N1)" cannot be used as a page name in this wiki.
