Difference between revisions of "Ec-13 002040"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
 
(Created page with "Category:Gene == Gene Ec-13_002040 == * Synonym(s): ** Esi_0285_0001 ** Esi0285_0001 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+
== Gene Ec-13_002040 ==
−
* smiles:
+
−
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
−
* inchi key:
+
−
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
+
−
* common name:
+
−
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
−
* molecular weight:
+
−
** 447.424   
+
 
* Synonym(s):
 
* Synonym(s):
−
** di-trans,poly-cis-geranylgeranyl diphosphate
+
** Esi_0285_0001
−
** ω,E,E,Z-geranylgeranyl diphosphate
+
** Esi0285_0001
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
−
* [[RXN-13323]]
+
== Pathways associated ==
−
* [[RXN0-5180]]
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=Esi_0285_0001|Esi0285_0001}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
+
{{#set: reaction associated=RXN-8443}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
+
−
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
−
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
+
−
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
−
{{#set: molecular weight=447.424    }}
+
−
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
+
−
{{#set: consumed or produced by=RXN-13323|RXN0-5180}}
+

Latest revision as of 19:14, 21 March 2018

Gene Ec-13_002040

  • Synonym(s):
    • Esi_0285_0001
    • Esi0285_0001

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_002040&oldid=25547"