Difference between revisions of "RXN0-7192"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13936 CPD-13936] == * smiles: ** CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7192 RXN0-7192] == * direction: ** LEFT-TO-RIGHT * common name: ** Biotin/lipoate A/B protein...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13936 CPD-13936] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7192 RXN0-7192] ==
* smiles:
+
* direction:
** CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(C(O)C(C(O)C(O3)COC6(C(O)C(C(O)C(COC5(OC(CO)C(O)C(O)C(OC4(C(O)C(O)C(O)C(CO)O4))5))O6)OC7(C(C(O)C(O)C(CO)O7)OC8(C(O)C(O)C(O)C(CO)O8))))OC%14(OC(CO)C(O)C(O)C(OC%13(OC(CO)C(O)C(O)C(OC9(C(O)C(C(O)C(O9)CO)OC%10(C(O)C(C(O)C(O%10)CO)OC%12(OC(CO)C(O)C(O)C(OC%11(C(O)C(O)C(O)C(CO)O%11))%12))))%13))%14))))O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=KUYCTNQKTFGPMI-SXHURMOUSA-N
+
 
* common name:
 
* common name:
** Glc3Man9GlcNAc2
+
** Biotin/lipoate A/B protein ligase
* molecular weight:
+
** Biotin/lipoate A/B protein ligase family
** 2370.108   
+
** biotin-[acetyl-CoA-carboxylase] ligase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.3.4.15 EC-6.3.4.15]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[3.2.1.106-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[BIOTIN]][c] '''=>''' 1 [[BIO-5-AMP]][c] '''+''' 1 [[PPI]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 ATP[c] '''+''' 1 biotin[c] '''=>''' 1 biotinyl-5'-adenylate[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-00_003530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-01_008620]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-05_005190]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-11_004970]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658561 90658561]
+
{{#set: common name=Biotin/lipoate A/B protein ligase}}
{{#set: smiles=CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(C(O)C(C(O)C(O3)COC6(C(O)C(C(O)C(COC5(OC(CO)C(O)C(O)C(OC4(C(O)C(O)C(O)C(CO)O4))5))O6)OC7(C(C(O)C(O)C(CO)O7)OC8(C(O)C(O)C(O)C(CO)O8))))OC%14(OC(CO)C(O)C(O)C(OC%13(OC(CO)C(O)C(O)C(OC9(C(O)C(C(O)C(O9)CO)OC%10(C(O)C(C(O)C(O%10)CO)OC%12(OC(CO)C(O)C(O)C(OC%11(C(O)C(O)C(O)C(CO)O%11))%12))))%13))%14))))O)}}
+
{{#set: common name=Biotin/lipoate A/B protein ligase family}}
{{#set: inchi key=InChIKey=KUYCTNQKTFGPMI-SXHURMOUSA-N}}
+
{{#set: common name=biotin-[acetyl-CoA-carboxylase] ligase}}
{{#set: common name=Glc3Man9GlcNAc2}}
+
{{#set: ec number=EC-6.3.4.15}}
{{#set: molecular weight=2370.108    }}
+
{{#set: gene associated=Ec-00_003530|Ec-01_008620|Ec-05_005190|Ec-11_004970}}
{{#set: consumed by=3.2.1.106-RXN}}
+
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:14, 21 March 2018

Reaction RXN0-7192

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Biotin/lipoate A/B protein ligase
    • Biotin/lipoate A/B protein ligase family
    • biotin-[acetyl-CoA-carboxylase] ligase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 ATP[c] + 1 biotin[c] => 1 biotinyl-5'-adenylate[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"biotin-[acetyl-CoA-carboxylase] ligase" cannot be used as a page name in this wiki.