Difference between revisions of "R-3-hydroxyhexanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxyhexanoyl-ACPs R-3-hydroxyhexanoyl-ACPs] == * common name: ** a (3R)-3-hydroxyhexanoy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxyhexanoyl-ACPs R-3-hydroxyhexanoyl-ACPs] ==
* smiles:
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
* inchi key:
+
** InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K
+
 
* common name:
 
* common name:
** all-trans-decaprenyl diphosphate
+
** a (3R)-3-hydroxyhexanoyl-[acp]
* molecular weight:
+
** 856.133   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a β-hydroxyhexanoyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9230]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9518]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a (3R)-3-hydroxyhexanoyl-[acp]}}
** [http://www.genome.jp/dbget-bin/www_bget?C17432 C17432]
+
{{#set: common name=a β-hydroxyhexanoyl-[acp]}}
* CHEBI:
+
{{#set: produced by=RXN-9518}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60721 60721]
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245574 25245574]
+
* HMDB : HMDB59616
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
{{#set: inchi key=InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K}}
+
{{#set: common name=all-trans-decaprenyl diphosphate}}
+
{{#set: molecular weight=856.133    }}
+
{{#set: consumed by=RXN-9230}}
+

Latest revision as of 19:14, 21 March 2018

Metabolite R-3-hydroxyhexanoyl-ACPs

  • common name:
    • a (3R)-3-hydroxyhexanoyl-[acp]
  • Synonym(s):
    • a β-hydroxyhexanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (3R)-3-hydroxyhexanoyl-[acp" cannot be used as a page name in this wiki.
"a β-hydroxyhexanoyl-[acp" cannot be used as a page name in this wiki.